C16H26ClN3O5S — CID 119690162
2-(2-methoxyethylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide;hydrochloride (PubChem CID 119690162) has the molecular formula C16H26ClN3O5S and a molecular weight of 407.92 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119690162 |
| Molecular Formula | C16H26ClN3O5S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCc1ccc(S(=O)(=O)N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C16H25N3O5S.ClH/c1-23-9-6-17-13-16(20)18-12-14-2-4-15(5-3-14)25(21,22)19-7-10-24-11-8-19;/h2-5,17H,6-13H2,1H3,(H,18,20);1H |
| InChIKey | LXSWBJRCGPLGRK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|