C14H23N3O4S — CID 119821890
N-[[4-(ethylsulfamoyl)phenyl]methyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119821890) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[[4-(ethylsulfamoyl)phenyl]methyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[[4-(ethylsulfamoyl)phenyl]methyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119821890 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[[4-(ethylsulfamoyl)phenyl]methyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | CCNS(=O)(=O)c1ccc(CNC(=O)CNCCOC)cc1 |
| InChI | InChI=1S/C14H23N3O4S/c1-3-17-22(19,20)13-6-4-12(5-7-13)10-16-14(18)11-15-8-9-21-2/h4-7,15,17H,3,8-11H2,1-2H3,(H,16,18) |
| InChIKey | PEKBOBATAJIAHK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|