C12H18N2O5S — CID 108735953
methyl N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]carbamate (PubChem CID 108735953) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is methyl N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]carbamate.
| Compound Name | methyl N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 108735953 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]carbamate |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)OC)cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-18-8-7-14-20(16,17)11-5-3-10(4-6-11)9-13-12(15)19-2/h3-6,14H,7-9H2,1-2H3,(H,13,15) |
| InChIKey | AHSHKAYUPZXCSM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|