C15H24N4O3S — CID 110934369
1-cyclopropyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine (PubChem CID 110934369) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-cyclopropyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110934369 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-cyclopropyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NCCOC)cc1)NC1CC1 |
| InChI | InChI=1S/C15H24N4O3S/c1-16-15(19-13-5-6-13)17-11-12-3-7-14(8-4-12)23(20,21)18-9-10-22-2/h3-4,7-8,13,18H,5-6,9-11H2,1-2H3,(H2,16,17,19) |
| InChIKey | GIEZFRLFGRBBKQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|