C16H27IN4O3S — CID 111237570
1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide (PubChem CID 111237570) has the molecular formula C16H27IN4O3S and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111237570 |
| Molecular Formula | C16H27IN4O3S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)NC(C)COC.I |
| InChI | InChI=1S/C16H26N4O3S.HI/c1-12(11-23-3)19-16(17-2)18-10-13-4-8-15(9-5-13)24(21,22)20-14-6-7-14;/h4-5,8-9,12,14,20H,6-7,10-11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | BVMGYRUFCAHJHG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|