C20H35IN4O2S — CID 111127768
1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(2-ethylhexyl)-2-methylguanidine;hydroiodide (PubChem CID 111127768) has the molecular formula C20H35IN4O2S and a molecular weight of 522.50 g/mol. Its IUPAC name is 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(2-ethylhexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(2-ethylhexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111127768 |
| Molecular Formula | C20H35IN4O2S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(2-ethylhexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N\C)NCc1ccc(S(=O)(=O)NC2CC2)cc1.I |
| InChI | InChI=1S/C20H34N4O2S.HI/c1-4-6-7-16(5-2)14-22-20(21-3)23-15-17-8-12-19(13-9-17)27(25,26)24-18-10-11-18;/h8-9,12-13,16,18,24H,4-7,10-11,14-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | IMNRKTDWHCTPFI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|