C13H21IN4O2S — CID 110917458
1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110917458) has the molecular formula C13H21IN4O2S and a molecular weight of 424.31 g/mol. Its IUPAC name is 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110917458 |
| Molecular Formula | C13H21IN4O2S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccc(S(=O)(=O)NC2CC2)cc1.I |
| InChI | InChI=1S/C13H20N4O2S.HI/c1-14-13(15-2)16-9-10-3-7-12(8-4-10)20(18,19)17-11-5-6-11;/h3-4,7-8,11,17H,5-6,9H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | MSRGTKQZPAZFBX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|