C21H35N5O2S — CID 111325414
1-[3-(azepan-1-yl)propyl]-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111325414) has the molecular formula C21H35N5O2S and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111325414 |
| Molecular Formula | C21H35N5O2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C21H35N5O2S/c1-22-21(23-13-6-16-26-14-4-2-3-5-15-26)24-17-18-7-11-20(12-8-18)29(27,28)25-19-9-10-19/h7-8,11-12,19,25H,2-6,9-10,13-17H2,1H3,(H2,22,23,24) |
| InChIKey | AAQKYCHRZHBRPF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|