C17H28N4O2S2 — CID 111609854
1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111609854) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111609854 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)NCC(C)(C)SC |
| InChI | InChI=1S/C17H28N4O2S2/c1-17(2,24-4)12-20-16(18-3)19-11-13-5-9-15(10-6-13)25(22,23)21-14-7-8-14/h5-6,9-10,14,21H,7-8,11-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | PXENMZXCNPEMKQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|