C15H25N3O2S2 — CID 111611926
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine (PubChem CID 111611926) has the molecular formula C15H25N3O2S2 and a molecular weight of 343.52 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111611926 |
| Molecular Formula | C15H25N3O2S2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(C)(=O)=O)cc1)NCC(C)(C)SC |
| InChI | InChI=1S/C15H25N3O2S2/c1-15(2,21-4)11-18-14(16-3)17-10-12-6-8-13(9-7-12)22(5,19)20/h6-9H,10-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | SSUVPVMCTFUFTQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|