C13H21ClN4S — CID 111610824
1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111610824) has the molecular formula C13H21ClN4S and a molecular weight of 300.86 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111610824 |
| Molecular Formula | C13H21ClN4S |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(Cl)nc1)NCC(C)(C)SC |
| InChI | InChI=1S/C13H21ClN4S/c1-13(2,19-4)9-18-12(15-3)17-8-10-5-6-11(14)16-7-10/h5-7H,8-9H2,1-4H3,(H2,15,17,18) |
| InChIKey | ZDGVERWLSVNJAR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|