C10H10ClF3N4O — CID 15030446
N-[N-[(6-chloro-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]-2,2,2-trifluoroacetamide (PubChem CID 15030446) has the molecular formula C10H10ClF3N4O and a molecular weight of 294.66 g/mol. Its IUPAC name is N-[N-[(6-chloro-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[N-[(6-chloro-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15030446 |
| Molecular Formula | C10H10ClF3N4O |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N-[N-[(6-chloro-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]-2,2,2-trifluoroacetamide |
| SMILES | C/N=C(/NCc1ccc(Cl)nc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N4O/c1-15-9(18-8(19)10(12,13)14)17-5-6-2-3-7(11)16-4-6/h2-4H,5H2,1H3,(H2,15,17,18,19) |
| InChIKey | PURXTLZBIZTBDJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|