C12H16ClN7 — CID 111706843
1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111706843) has the molecular formula C12H16ClN7 and a molecular weight of 293.76 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111706843 |
| Molecular Formula | C12H16ClN7 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(Cl)nc1)NCc1ncnn1C |
| InChI | InChI=1S/C12H16ClN7/c1-14-12(17-7-11-18-8-19-20(11)2)16-6-9-3-4-10(13)15-5-9/h3-5,8H,6-7H2,1-2H3,(H2,14,16,17) |
| InChIKey | MMECTTAFLSWLEA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|