C17H22N8 — CID 111706465
1-[(1-benzylpyrazol-4-yl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111706465) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-[(1-benzylpyrazol-4-yl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(1-benzylpyrazol-4-yl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111706465 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(1-benzylpyrazol-4-yl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cnn(Cc2ccccc2)c1)NCc1ncnn1C |
| InChI | InChI=1S/C17H22N8/c1-18-17(20-10-16-21-13-23-24(16)2)19-8-15-9-22-25(12-15)11-14-6-4-3-5-7-14/h3-7,9,12-13H,8,10-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | NHNOFHICJGLCIW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|