C15H22N6O — CID 111705607
1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705607) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705607 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(C)c(OC)c1)NCc1ncnn1C |
| InChI | InChI=1S/C15H22N6O/c1-11-5-6-12(7-13(11)22-4)8-17-15(16-2)18-9-14-19-10-20-21(14)3/h5-7,10H,8-9H2,1-4H3,(H2,16,17,18) |
| InChIKey | OLDQYMOEYHSLAF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|