C20H33N7O2 — CID 111707429
1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111707429) has the molecular formula C20H33N7O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111707429 |
| Molecular Formula | C20H33N7O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN(CC)CCOc1ccc(CN/C(=N/C)NCc2ncnn2C)cc1OC |
| InChI | InChI=1S/C20H33N7O2/c1-6-27(7-2)10-11-29-17-9-8-16(12-18(17)28-5)13-22-20(21-3)23-14-19-24-15-25-26(19)4/h8-9,12,15H,6-7,10-11,13-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | KAMRBOJNPAGUDS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|