C25H47N5O2 — CID 110997867
1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine (PubChem CID 110997867) has the molecular formula C25H47N5O2 and a molecular weight of 449.68 g/mol. Its IUPAC name is 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine.
| Compound Name | 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997867 |
| Molecular Formula | C25H47N5O2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | 1-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1ccc(OCCN(CC)CC)c(OC)c1 |
| InChI | InChI=1S/C25H47N5O2/c1-8-29(9-2)16-12-13-21(5)28-25(26-6)27-20-22-14-15-23(24(19-22)31-7)32-18-17-30(10-3)11-4/h14-15,19,21H,8-13,16-18,20H2,1-7H3,(H2,26,27,28) |
| InChIKey | ZKILMVFGNDPWDH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|