C16H22N6O3 — CID 111705553
methyl 2-methoxy-5-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzoate (PubChem CID 111705553) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111705553 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl 2-methoxy-5-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
| SMILES | C/N=C(/NCc1ccc(OC)c(C(=O)OC)c1)NCc1ncnn1C |
| InChI | InChI=1S/C16H22N6O3/c1-17-16(19-9-14-20-10-21-22(14)2)18-8-11-5-6-13(24-3)12(7-11)15(23)25-4/h5-7,10H,8-9H2,1-4H3,(H2,17,18,19) |
| InChIKey | ATCCJICLHJTYOF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|