C16H25IN6 — CID 111706572
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(2,4,6-trimethylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111706572) has the molecular formula C16H25IN6 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(2,4,6-trimethylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(2,4,6-trimethylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111706572 |
| Molecular Formula | C16H25IN6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(2,4,6-trimethylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1c(C)cc(C)cc1C)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H24N6.HI/c1-11-6-12(2)14(13(3)7-11)8-18-16(17-4)19-9-15-20-10-21-22(15)5;/h6-7,10H,8-9H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | BLBCMUITLBIRPV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|