C12H25IN6 — CID 111708160
2-methyl-1-(4-methylpentyl)-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111708160) has the molecular formula C12H25IN6 and a molecular weight of 380.28 g/mol. Its IUPAC name is 2-methyl-1-(4-methylpentyl)-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylpentyl)-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111708160 |
| Molecular Formula | C12H25IN6 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-methyl-1-(4-methylpentyl)-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)NCc1ncnn1C.I |
| InChI | InChI=1S/C12H24N6.HI/c1-10(2)6-5-7-14-12(13-3)15-8-11-16-9-17-18(11)4;/h9-10H,5-8H2,1-4H3,(H2,13,14,15);1H |
| InChIKey | KQCWJFRCGGIXKH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|