C16H23IN8 — CID 111705636
1-[3-(benzimidazol-1-yl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111705636) has the molecular formula C16H23IN8 and a molecular weight of 454.32 g/mol. Its IUPAC name is 1-[3-(benzimidazol-1-yl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(benzimidazol-1-yl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705636 |
| Molecular Formula | C16H23IN8 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-[3-(benzimidazol-1-yl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1cnc2ccccc21)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H22N8.HI/c1-17-16(19-10-15-20-11-22-23(15)2)18-8-5-9-24-12-21-13-6-3-4-7-14(13)24;/h3-4,6-7,11-12H,5,8-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | RNSCGOWLUXXELE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|