C12H23F3IN7 — CID 111707722
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111707722) has the molecular formula C12H23F3IN7 and a molecular weight of 449.26 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111707722 |
| Molecular Formula | C12H23F3IN7 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCc1ncnn1C.I |
| InChI | InChI=1S/C12H22F3N7.HI/c1-16-11(18-7-10-19-9-20-22(10)3)17-5-4-6-21(2)8-12(13,14)15;/h9H,4-8H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | MGXNCBJJCSDDTE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|