C16H25N7 — CID 111705415
2-methyl-1-[3-(N-methylanilino)propyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705415) has the molecular formula C16H25N7 and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-methyl-1-[3-(N-methylanilino)propyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(N-methylanilino)propyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705415 |
| Molecular Formula | C16H25N7 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-methyl-1-[3-(N-methylanilino)propyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCN(C)c1ccccc1)NCc1ncnn1C |
| InChI | InChI=1S/C16H25N7/c1-17-16(19-12-15-20-13-21-23(15)3)18-10-7-11-22(2)14-8-5-4-6-9-14/h4-6,8-9,13H,7,10-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | HEVUDAHKDNXTRO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|