C14H21IN6O2S — CID 111705050
1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111705050) has the molecular formula C14H21IN6O2S and a molecular weight of 464.33 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705050 |
| Molecular Formula | C14H21IN6O2S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)c1ccccc1)NCc1ncnn1C.I |
| InChI | InChI=1S/C14H20N6O2S.HI/c1-15-14(17-10-13-18-11-19-20(13)2)16-8-9-23(21,22)12-6-4-3-5-7-12;/h3-7,11H,8-10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | VHMNNHDPIASFCI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|