C15H22ClIN6 — CID 111708162
1-[3-(4-chlorophenyl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111708162) has the molecular formula C15H22ClIN6 and a molecular weight of 448.74 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-chlorophenyl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111708162 |
| Molecular Formula | C15H22ClIN6 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1-[3-(4-chlorophenyl)propyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(Cl)cc1)NCc1ncnn1C.I |
| InChI | InChI=1S/C15H21ClN6.HI/c1-17-15(19-10-14-20-11-21-22(14)2)18-9-3-4-12-5-7-13(16)8-6-12;/h5-8,11H,3-4,9-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | ZSHGTQAJAMERQJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|