C15H24IN7O2S — CID 111705462
1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111705462) has the molecular formula C15H24IN7O2S and a molecular weight of 493.38 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705462 |
| Molecular Formula | C15H24IN7O2S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)NCc1ccccc1)NCc1ncnn1C.I |
| InChI | InChI=1S/C15H23N7O2S.HI/c1-16-15(18-11-14-19-12-20-22(14)2)17-8-9-25(23,24)21-10-13-6-4-3-5-7-13;/h3-7,12,21H,8-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | NSQDVJQEZVTPNP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|