C17H28IN7O2S — CID 111698640
1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111698640) has the molecular formula C17H28IN7O2S and a molecular weight of 521.43 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111698640 |
| Molecular Formula | C17H28IN7O2S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCS(=O)(=O)NCc1ccccc1.I |
| InChI | InChI=1S/C17H27N7O2S.HI/c1-3-16-23-21-14-24(16)11-9-19-17(18-2)20-10-12-27(25,26)22-13-15-7-5-4-6-8-15;/h4-8,14,22H,3,9-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | LGYHKQPHCBDIJR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|