C17H27N7O2S — CID 111698641
1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111698641) has the molecular formula C17H27N7O2S and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111698641 |
| Molecular Formula | C17H27N7O2S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H27N7O2S/c1-3-16-23-21-14-24(16)11-9-19-17(18-2)20-10-12-27(25,26)22-13-15-7-5-4-6-8-15/h4-8,14,22H,3,9-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | LLCKSHCXSXTMMJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|