C16H23IN4O2S2 — CID 111938900
1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111938900) has the molecular formula C16H23IN4O2S2 and a molecular weight of 494.42 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111938900 |
| Molecular Formula | C16H23IN4O2S2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)NCc1ccccc1)NCc1ccsc1.I |
| InChI | InChI=1S/C16H22N4O2S2.HI/c1-17-16(19-11-15-7-9-23-13-15)18-8-10-24(21,22)20-12-14-5-3-2-4-6-14;/h2-7,9,13,20H,8,10-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | PWZRHTATZWZSPB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|