C15H23N7O2S — CID 111706857
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111706857) has the molecular formula C15H23N7O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111706857 |
| Molecular Formula | C15H23N7O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)N(C)C)NCc1ncnn1C |
| InChI | InChI=1S/C15H23N7O2S/c1-16-15(18-10-14-19-11-20-22(14)4)17-9-12-7-5-6-8-13(12)25(23,24)21(2)3/h5-8,11H,9-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | NWMNYOWSKHAEEY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|