C17H31IN4O2S — CID 111943432
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide (PubChem CID 111943432) has the molecular formula C17H31IN4O2S and a molecular weight of 482.43 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111943432 |
| Molecular Formula | C17H31IN4O2S |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)NCc1ccccc1S(=O)(=O)N(C)C.I |
| InChI | InChI=1S/C17H30N4O2S.HI/c1-14(2)9-8-12-19-17(18-3)20-13-15-10-6-7-11-16(15)24(22,23)21(4)5;/h6-7,10-11,14H,8-9,12-13H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | OLZSNMOGXNXTRK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|