C19H32N4O2S — CID 111947009
1-(3-cyclopentylpropyl)-3-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111947009) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-(3-cyclopentylpropyl)-3-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(3-cyclopentylpropyl)-3-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111947009 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(3-cyclopentylpropyl)-3-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCC1CCCC1)NCc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H32N4O2S/c1-20-19(21-14-8-11-16-9-4-5-10-16)22-15-17-12-6-7-13-18(17)26(24,25)23(2)3/h6-7,12-13,16H,4-5,8-11,14-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | ZFYFVMXDCUNXKX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|