C18H27N7O3S — CID 111707739
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine (PubChem CID 111707739) has the molecular formula C18H27N7O3S and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111707739 |
| Molecular Formula | C18H27N7O3S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1CS(=O)(=O)N1CCOCC1)NCc1ncnn1C |
| InChI | InChI=1S/C18H27N7O3S/c1-19-18(21-12-17-22-14-23-24(17)2)20-11-15-5-3-4-6-16(15)13-29(26,27)25-7-9-28-10-8-25/h3-6,14H,7-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | DJQSUFWKLUWEPL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|