C17H26F3IN4O3S — CID 109472426
2-methyl-1-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472426) has the molecular formula C17H26F3IN4O3S and a molecular weight of 550.39 g/mol. Its IUPAC name is 2-methyl-1-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472426 |
| Molecular Formula | C17H26F3IN4O3S |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 2-methyl-1-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccccc1CS(=O)(=O)N1CCOCC1.I |
| InChI | InChI=1S/C17H25F3N4O3S.HI/c1-21-16(22-7-6-17(18,19)20)23-12-14-4-2-3-5-15(14)13-28(25,26)24-8-10-27-11-9-24;/h2-5H,6-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | YTPGCGKUSVNYGR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|