C17H23F3N4O — CID 109473541
2-methyl-1-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473541) has the molecular formula C17H23F3N4O and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-methyl-1-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473541 |
| Molecular Formula | C17H23F3N4O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-methyl-1-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccccc1CN1CCCC1=O |
| InChI | InChI=1S/C17H23F3N4O/c1-21-16(22-9-8-17(18,19)20)23-11-13-5-2-3-6-14(13)12-24-10-4-7-15(24)25/h2-3,5-6H,4,7-12H2,1H3,(H2,21,22,23) |
| InChIKey | SMERVXADZMMJSD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|