C21H27IN4O — CID 110952355
1-benzyl-2-methyl-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 110952355) has the molecular formula C21H27IN4O and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-2-methyl-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110952355 |
| Molecular Formula | C21H27IN4O |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 1-benzyl-2-methyl-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1)NCc1ccccc1CN1CCCC1=O.I |
| InChI | InChI=1S/C21H26N4O.HI/c1-22-21(23-14-17-8-3-2-4-9-17)24-15-18-10-5-6-11-19(18)16-25-13-7-12-20(25)26;/h2-6,8-11H,7,12-16H2,1H3,(H2,22,23,24);1H |
| InChIKey | RKKIMRDJDIVFBG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|