C22H29IN4O — CID 111245312
2-methyl-1-[(4-methylphenyl)methyl]-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111245312) has the molecular formula C22H29IN4O and a molecular weight of 492.41 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylphenyl)methyl]-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methylphenyl)methyl]-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111245312 |
| Molecular Formula | C22H29IN4O |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-methyl-1-[(4-methylphenyl)methyl]-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)NCc1ccc(CN2CCCC2=O)cc1.I |
| InChI | InChI=1S/C22H28N4O.HI/c1-17-5-7-18(8-6-17)14-24-22(23-2)25-15-19-9-11-20(12-10-19)16-26-13-3-4-21(26)27;/h5-12H,3-4,13-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | FOZCJTIJGIKCNF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|