C19H31F3IN5 — CID 109472230
1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472230) has the molecular formula C19H31F3IN5 and a molecular weight of 513.39 g/mol. Its IUPAC name is 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472230 |
| Molecular Formula | C19H31F3IN5 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(Cc2ccccc2CN/C(=N/C)NCCC(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H30F3N5.HI/c1-3-26-10-12-27(13-11-26)15-17-7-5-4-6-16(17)14-25-18(23-2)24-9-8-19(20,21)22;/h4-7H,3,8-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | VIXUDUPOVKLBKS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|