C17H27F3N4 — CID 109472519
1-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472519) has the molecular formula C17H27F3N4 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472519 |
| Molecular Formula | C17H27F3N4 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN(CC)Cc1ccccc1CN/C(=N/C)NCCC(F)(F)F |
| InChI | InChI=1S/C17H27F3N4/c1-4-24(5-2)13-15-9-7-6-8-14(15)12-23-16(21-3)22-11-10-17(18,19)20/h6-9H,4-5,10-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | RUWDIPHMZQTQLJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|