C13H17F5IN3O — CID 112000000
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 112000000) has the molecular formula C13H17F5IN3O and a molecular weight of 453.19 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 112000000 |
| Molecular Formula | C13H17F5IN3O |
| Molecular Weight | 453.19 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C13H16F5N3O.HI/c1-19-12(20-7-6-13(16,17)18)21-8-9-4-2-3-5-10(9)22-11(14)15;/h2-5,11H,6-8H2,1H3,(H2,19,20,21);1H |
| InChIKey | QWWNJSPZPRRMAQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|