C16H24F5IN4O — CID 111866419
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111866419) has the molecular formula C16H24F5IN4O and a molecular weight of 510.29 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111866419 |
| Molecular Formula | C16H24F5IN4O |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C16H23F5N4O.HI/c1-22-15(23-8-5-9-25(2)11-16(19,20)21)24-10-12-6-3-4-7-13(12)26-14(17)18;/h3-4,6-7,14H,5,8-11H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | DRKBERTZOCESST-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|