C14H18F6IN3O — CID 109472012
2-methyl-1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472012) has the molecular formula C14H18F6IN3O and a molecular weight of 485.21 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472012 |
| Molecular Formula | C14H18F6IN3O |
| Molecular Weight | 485.21 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccccc1OCC(F)(F)F.I |
| InChI | InChI=1S/C14H17F6N3O.HI/c1-21-12(22-7-6-13(15,16)17)23-8-10-4-2-3-5-11(10)24-9-14(18,19)20;/h2-5H,6-9H2,1H3,(H2,21,22,23);1H |
| InChIKey | OMDIMFVRVOFCRU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|