C18H21F3N4O — CID 111193116
2-methyl-1-(2-pyridin-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111193116) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-methyl-1-(2-pyridin-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111193116 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O/c1-22-17(24-11-9-15-7-4-5-10-23-15)25-12-14-6-2-3-8-16(14)26-13-18(19,20)21/h2-8,10H,9,11-13H2,1H3,(H2,22,24,25) |
| InChIKey | JIIMYSWLWMTRCN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|