C20H22N4 — CID 111192120
2-methyl-1-(naphthalen-1-ylmethyl)-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192120) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-methyl-1-(naphthalen-1-ylmethyl)-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-(naphthalen-1-ylmethyl)-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192120 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-methyl-1-(naphthalen-1-ylmethyl)-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H22N4/c1-21-20(23-14-12-18-10-4-5-13-22-18)24-15-17-9-6-8-16-7-2-3-11-19(16)17/h2-11,13H,12,14-15H2,1H3,(H2,21,23,24) |
| InChIKey | KFZASZCPACWLCM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|