C15H22F3N7 — CID 111015445
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015445) has the molecular formula C15H22F3N7 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015445 |
| Molecular Formula | C15H22F3N7 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C15H22F3N7/c1-19-14(20-7-5-8-24(2)11-15(16,17)18)21-10-13-23-22-12-6-3-4-9-25(12)13/h3-4,6,9H,5,7-8,10-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | XFCBZDZAFMYIGO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|