C18H23IN6O — CID 111015028
2-methyl-1-(3-phenoxypropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015028) has the molecular formula C18H23IN6O and a molecular weight of 466.33 g/mol. Its IUPAC name is 2-methyl-1-(3-phenoxypropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-phenoxypropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015028 |
| Molecular Formula | C18H23IN6O |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-methyl-1-(3-phenoxypropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOc1ccccc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H22N6O.HI/c1-19-18(20-11-7-13-25-15-8-3-2-4-9-15)21-14-17-23-22-16-10-5-6-12-24(16)17;/h2-6,8-10,12H,7,11,13-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | VJTXWFRGRCZJDB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|