C15H21IN8 — CID 111016564
2-methyl-1-(3-pyrazol-1-ylpropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111016564) has the molecular formula C15H21IN8 and a molecular weight of 440.29 g/mol. Its IUPAC name is 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111016564 |
| Molecular Formula | C15H21IN8 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C15H20N8.HI/c1-16-15(17-7-4-9-22-10-5-8-19-22)18-12-14-21-20-13-6-2-3-11-23(13)14;/h2-3,5-6,8,10-11H,4,7,9,12H2,1H3,(H2,16,17,18);1H |
| InChIKey | CSJDEWDSHMEITH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|