C23H25IN6 — CID 111015668
1-(2,2-diphenylethyl)-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015668) has the molecular formula C23H25IN6 and a molecular weight of 512.40 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2,2-diphenylethyl)-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015668 |
| Molecular Formula | C23H25IN6 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1-(2,2-diphenylethyl)-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C23H24N6.HI/c1-24-23(26-17-22-28-27-21-14-8-9-15-29(21)22)25-16-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19;/h2-15,20H,16-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | IBCHLTXXGGJMJV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|