C19H25IN6O2 — CID 111787828
1-[2-(4-methoxyphenoxy)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111787828) has the molecular formula C19H25IN6O2 and a molecular weight of 496.35 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenoxy)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111787828 |
| Molecular Formula | C19H25IN6O2 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC(C)Oc1ccc(OC)cc1.I |
| InChI | InChI=1S/C19H24N6O2.HI/c1-14(27-16-9-7-15(26-3)8-10-16)12-21-19(20-2)22-13-18-24-23-17-6-4-5-11-25(17)18;/h4-11,14H,12-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | YLQAQWCWYPDEDR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|