C19H25IN6O3 — CID 111016170
2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111016170) has the molecular formula C19H25IN6O3 and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111016170 |
| Molecular Formula | C19H25IN6O3 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(OC)cc(OC)cc1OC)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C19H24N6O3.HI/c1-20-19(22-12-18-24-23-17-7-5-6-8-25(17)18)21-11-14-15(27-3)9-13(26-2)10-16(14)28-4;/h5-10H,11-12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | NYYKAMKMYSNVBN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|